About acetyl(hydroxy)azanide;rhenium
acetyl(hydroxy)azanide;rhenium (PubChem CID 59071290) has the molecular formula C2H4NO2Re-
and a molecular weight of 260.27 g/mol. Its IUPAC name is acetyl(hydroxy)azanide;rhenium.
Molecular Properties
| Compound Name | acetyl(hydroxy)azanide;rhenium |
| PubChem CID | 59071290 |
| Molecular Formula | C2H4NO2Re- |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | acetyl(hydroxy)azanide;rhenium |
| SMILES | CC(=O)[N-]O.[Re] |
| InChI | InChI=1S/C2H5NO2.Re/c1-2(4)3-5;/h1H3,(H2,3,4,5);/p-1 |
| InChIKey | FULMQKJQTCDTLE-UHFFFAOYSA-M |
| XLogP | 0.29 |
| TPSA | 51.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetyl(hydroxy)azanide;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl(hydroxy)azanide;rhenium?
The IUPAC name of acetyl(hydroxy)azanide;rhenium (CID 59071290) is acetyl(hydroxy)azanide;rhenium.
What is the SMILES notation for acetyl(hydroxy)azanide;rhenium?
The canonical SMILES for acetyl(hydroxy)azanide;rhenium is CC(=O)[N-]O.[Re].
What is the InChIKey of acetyl(hydroxy)azanide;rhenium?
The InChIKey is FULMQKJQTCDTLE-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H5NO2.Re/c1-2(4)3-5;/h1H3,(H2,3,4,5);/p-1.
What are the key properties of acetyl(hydroxy)azanide;rhenium?
acetyl(hydroxy)azanide;rhenium has a molecular weight of 260.27 g/mol, XLogP of 0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl(hydroxy)azanide;rhenium is sourced from PubChem (CID 59071290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).