About barium(2+);ethanethioate
barium(2+);ethanethioate (PubChem CID 10469325) has the molecular formula C4H6BaO2S2
and a molecular weight of 287.55 g/mol. Its IUPAC name is barium(2+);ethanethioate.
Molecular Properties
| Compound Name | barium(2+);ethanethioate |
| PubChem CID | 10469325 |
| Molecular Formula | C4H6BaO2S2 |
| Molecular Weight | 287.55 g/mol |
| Exact Mass | 287.89 |
| IUPAC Name | barium(2+);ethanethioate |
| SMILES | CC(=O)[S-].CC(=O)[S-].[Ba+2] |
| InChI | InChI=1S/2C2H4OS.Ba/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | QYYMGSIMPJGKQT-UHFFFAOYSA-L |
| XLogP | -0.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.55 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);ethanethioate?
The IUPAC name of barium(2+);ethanethioate (CID 10469325) is barium(2+);ethanethioate.
What is the SMILES notation for barium(2+);ethanethioate?
The canonical SMILES for barium(2+);ethanethioate is CC(=O)[S-].CC(=O)[S-].[Ba+2].
What is the InChIKey of barium(2+);ethanethioate?
The InChIKey is QYYMGSIMPJGKQT-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H4OS.Ba/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2.
What are the key properties of barium(2+);ethanethioate?
barium(2+);ethanethioate has a molecular weight of 287.55 g/mol, XLogP of -0.22, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);ethanethioate is sourced from PubChem (CID 10469325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).