C19H16Cl2N8O — CID 161039921
3-chloro-1-pyridin-3-ylpyrazol-4-amine;N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 161039921) has the molecular formula C19H16Cl2N8O and a molecular weight of 443.30 g/mol. Its IUPAC name is 3-chloro-1-pyridin-3-ylpyrazol-4-amine;N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | 3-chloro-1-pyridin-3-ylpyrazol-4-amine;N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 161039921 |
| Molecular Formula | C19H16Cl2N8O |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 3-chloro-1-pyridin-3-ylpyrazol-4-amine;N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1cn(-c2cccnc2)nc1Cl.Nc1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C11H9ClN4O.C8H7ClN4/c1-2-10(17)14-9-7-16(15-11(9)12)8-4-3-5-13-6-8;9-8-7(10)5-13(12-8)6-2-1-3-11-4-6/h2-7H,1H2,(H,14,17);1-5H,10H2 |
| InChIKey | UATAPGJCQXAIAP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 116.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|