C31H33F3O2S — CID 161046367
adamantane-1-carboxylate;1,1,1-trifluoroethane;triphenylsulfanium (PubChem CID 161046367) has the molecular formula C31H33F3O2S and a molecular weight of 526.66 g/mol. Its IUPAC name is adamantane-1-carboxylate;1,1,1-trifluoroethane;triphenylsulfanium.
| Compound Name | adamantane-1-carboxylate;1,1,1-trifluoroethane;triphenylsulfanium |
|---|---|
| PubChem CID | 161046367 |
| Molecular Formula | C31H33F3O2S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | adamantane-1-carboxylate;1,1,1-trifluoroethane;triphenylsulfanium |
| SMILES | CC(F)(F)F.O=C([O-])C12CC3CC(CC(C3)C1)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C11H16O2.C2H3F3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11;1-2(3,4)5/h1-15H;7-9H,1-6H2,(H,12,13);1H3/q+1;;/p-1 |
| InChIKey | UBNYIYVXKVQQLK-UHFFFAOYSA-M |
| XLogP | 7.30 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|