C24H34O3 — CID 161059574
diphenylmethanone;4-ethyl-4-methyloctane-3,5-diol (PubChem CID 161059574) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is diphenylmethanone;4-ethyl-4-methyloctane-3,5-diol.
| Compound Name | diphenylmethanone;4-ethyl-4-methyloctane-3,5-diol |
|---|---|
| PubChem CID | 161059574 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | diphenylmethanone;4-ethyl-4-methyloctane-3,5-diol |
| SMILES | CCCC(O)C(C)(CC)C(O)CC.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C11H24O2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-5-8-10(13)11(4,7-3)9(12)6-2/h1-10H;9-10,12-13H,5-8H2,1-4H3 |
| InChIKey | UDFJLDDAIKCVON-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |