C33H27NO11 — CID 161060134
methyl 3-[(6aR,10aS,11aR)-8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]-5-[2-(furan-2-yl)-2-oxoethyl]benzoate (PubChem CID 161060134) has the molecular formula C33H27NO11 and a molecular weight of 613.58 g/mol. Its IUPAC name is methyl 3-[(6aR,10aS,11aR)-8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]-5-[2-(furan-2-yl)-2-oxoethyl]benzoate.
| Compound Name | methyl 3-[(6aR,10aS,11aR)-8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]-5-[2-(furan-2-yl)-2-oxoethyl]benzoate |
|---|---|
| PubChem CID | 161060134 |
| Molecular Formula | C33H27NO11 |
| Molecular Weight | 613.58 g/mol |
| Exact Mass | 613.16 |
| IUPAC Name | methyl 3-[(6aR,10aS,11aR)-8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]-5-[2-(furan-2-yl)-2-oxoethyl]benzoate |
| SMILES | COC(=O)c1cc(CC(=O)c2ccco2)cc(-c2ccc(O)c3c2C[C@H]2C[C@H]4CC(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C33H27NO11/c1-44-32(42)17-8-14(9-22(36)24-3-2-6-45-24)7-15(10-17)19-4-5-21(35)26-20(19)12-16-11-18-13-23(37)27(31(34)41)30(40)33(18,43)29(39)25(16)28(26)38/h2-8,10,16,18,35,38,40,43H,9,11-13H2,1H3,(H2,34,41)/t16-,18+,33+/m1/s1 |
| InChIKey | RAGGLPMSCBNRGQ-LURPTGHASA-N |
| XLogP | 2.90 |
| TPSA | 214.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.58 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|