C31H25N3O11 — CID 54723049
methyl 3-(8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl)-5-(1,2-oxazole-5-carbonylamino)benzoate (PubChem CID 54723049) has the molecular formula C31H25N3O11 and a molecular weight of 615.55 g/mol. Its IUPAC name is methyl 3-(8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl)-5-(1,2-oxazole-5-carbonylamino)benzoate.
| Compound Name | methyl 3-(8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl)-5-(1,2-oxazole-5-carbonylamino)benzoate |
|---|---|
| PubChem CID | 54723049 |
| Molecular Formula | C31H25N3O11 |
| Molecular Weight | 615.55 g/mol |
| Exact Mass | 615.15 |
| IUPAC Name | methyl 3-(8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl)-5-(1,2-oxazole-5-carbonylamino)benzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2ccno2)cc(-c2ccc(O)c3c2CC2CC4CC(=O)C(C(N)=O)=C(O)C4(O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C31H25N3O11/c1-44-30(42)14-6-12(8-16(9-14)34-29(41)21-4-5-33-45-21)17-2-3-19(35)23-18(17)10-13-7-15-11-20(36)24(28(32)40)27(39)31(15,43)26(38)22(13)25(23)37/h2-6,8-9,13,15,35,37,39,43H,7,10-11H2,1H3,(H2,32,40)(H,34,41) |
| InChIKey | FEYVJPKLLGJRBH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 239.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.55 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|