C34H33F3N4O8 — CID 161090120
benzyl (3R)-3-(hydroxycarbamoyl)-2-[2-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]acetyl]diazinane-1-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 161090120) has the molecular formula C34H33F3N4O8 and a molecular weight of 682.65 g/mol. Its IUPAC name is benzyl (3R)-3-(hydroxycarbamoyl)-2-[2-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]acetyl]diazinane-1-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | benzyl (3R)-3-(hydroxycarbamoyl)-2-[2-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]acetyl]diazinane-1-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161090120 |
| Molecular Formula | C34H33F3N4O8 |
| Molecular Weight | 682.65 g/mol |
| Exact Mass | 682.23 |
| IUPAC Name | benzyl (3R)-3-(hydroxycarbamoyl)-2-[2-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]acetyl]diazinane-1-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(COc2ccc(CC(=O)N3[C@@H](C(=O)NO)CCCN3C(=O)OCc3ccccc3)cc2)c2ccccc2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C32H32N4O6.C2HF3O2/c1-22-18-25(27-10-5-6-11-28(27)33-22)21-41-26-15-13-23(14-16-26)19-30(37)36-29(31(38)34-40)12-7-17-35(36)32(39)42-20-24-8-3-2-4-9-24;3-2(4,5)1(6)7/h2-6,8-11,13-16,18,29,40H,7,12,17,19-21H2,1H3,(H,34,38);(H,6,7)/t29-;/m1./s1 |
| InChIKey | UHBFJKUKOKKAJU-XXIQNXCHSA-N |
| XLogP | 5.35 |
| TPSA | 158.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|