C31H36F3O3PS — CID 161097569
dicyclohexyl(1H-inden-2-yl)phosphane;1H-inden-2-yl trifluoromethanesulfonate (PubChem CID 161097569) has the molecular formula C31H36F3O3PS and a molecular weight of 576.66 g/mol. Its IUPAC name is dicyclohexyl(1H-inden-2-yl)phosphane;1H-inden-2-yl trifluoromethanesulfonate.
| Compound Name | dicyclohexyl(1H-inden-2-yl)phosphane;1H-inden-2-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 161097569 |
| Molecular Formula | C31H36F3O3PS |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | dicyclohexyl(1H-inden-2-yl)phosphane;1H-inden-2-yl trifluoromethanesulfonate |
| SMILES | C1=C(P(C2CCCCC2)C2CCCCC2)Cc2ccccc21.O=S(=O)(OC1=Cc2ccccc2C1)C(F)(F)F |
| InChI | InChI=1S/C21H29P.C10H7F3O3S/c1-3-11-19(12-4-1)22(20-13-5-2-6-14-20)21-15-17-9-7-8-10-18(17)16-21;11-10(12,13)17(14,15)16-9-5-7-3-1-2-4-8(7)6-9/h7-10,15,19-20H,1-6,11-14,16H2;1-5H,6H2 |
| InChIKey | UHZKXDFHEVKNBV-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|