C25H30F3O4PS — CID 102164539
[4-(2-dicyclohexylphosphorylphenyl)phenyl] trifluoromethanesulfonate (PubChem CID 102164539) has the molecular formula C25H30F3O4PS and a molecular weight of 514.55 g/mol. Its IUPAC name is [4-(2-dicyclohexylphosphorylphenyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-(2-dicyclohexylphosphorylphenyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 102164539 |
| Molecular Formula | C25H30F3O4PS |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | [4-(2-dicyclohexylphosphorylphenyl)phenyl] trifluoromethanesulfonate |
| SMILES | O=P(c1ccccc1-c1ccc(OS(=O)(=O)C(F)(F)F)cc1)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C25H30F3O4PS/c26-25(27,28)34(30,31)32-20-17-15-19(16-18-20)23-13-7-8-14-24(23)33(29,21-9-3-1-4-10-21)22-11-5-2-6-12-22/h7-8,13-18,21-22H,1-6,9-12H2 |
| InChIKey | KYGHYLDKROOJJT-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|