C10H8Cl3N3O2S — CID 161113085
2-chlorobenzenesulfonamide;2,3-dichloropyrazine (PubChem CID 161113085) has the molecular formula C10H8Cl3N3O2S and a molecular weight of 340.62 g/mol. Its IUPAC name is 2-chlorobenzenesulfonamide;2,3-dichloropyrazine.
| Compound Name | 2-chlorobenzenesulfonamide;2,3-dichloropyrazine |
|---|---|
| PubChem CID | 161113085 |
| Molecular Formula | C10H8Cl3N3O2S |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 338.94 |
| IUPAC Name | 2-chlorobenzenesulfonamide;2,3-dichloropyrazine |
| SMILES | Clc1nccnc1Cl.NS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C6H6ClNO2S.C4H2Cl2N2/c7-5-3-1-2-4-6(5)11(8,9)10;5-3-4(6)8-2-1-7-3/h1-4H,(H2,8,9,10);1-2H |
| InChIKey | UJYMRKHGBAONQA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |