C26H32N4O3 — CID 161115068
9H-fluoren-9-ylmethyl N-[(5S)-10-azido-5-methyl-6-oxodecyl]carbamate (PubChem CID 161115068) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(5S)-10-azido-5-methyl-6-oxodecyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(5S)-10-azido-5-methyl-6-oxodecyl]carbamate |
|---|---|
| PubChem CID | 161115068 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(5S)-10-azido-5-methyl-6-oxodecyl]carbamate |
| SMILES | C[C@@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)CCCCN=[N+]=[N-] |
| InChI | InChI=1S/C26H32N4O3/c1-19(25(31)15-7-9-17-29-30-27)10-6-8-16-28-26(32)33-18-24-22-13-4-2-11-20(22)21-12-3-5-14-23(21)24/h2-5,11-14,19,24H,6-10,15-18H2,1H3,(H,28,32)/t19-/m0/s1 |
| InChIKey | MMLGYUDGPVOCHX-IBGZPJMESA-N |
| XLogP | 6.38 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|