C19H31N2O8PS — CID 161132903
1-[4,7-dioxo-7-(6-phosphonooxyhexylamino)heptyl]-4-(sulfinoamino)benzene (PubChem CID 161132903) has the molecular formula C19H31N2O8PS and a molecular weight of 478.50 g/mol. Its IUPAC name is 1-[4,7-dioxo-7-(6-phosphonooxyhexylamino)heptyl]-4-(sulfinoamino)benzene.
| Compound Name | 1-[4,7-dioxo-7-(6-phosphonooxyhexylamino)heptyl]-4-(sulfinoamino)benzene |
|---|---|
| PubChem CID | 161132903 |
| Molecular Formula | C19H31N2O8PS |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 1-[4,7-dioxo-7-(6-phosphonooxyhexylamino)heptyl]-4-(sulfinoamino)benzene |
| SMILES | O=C(CCCc1ccc(NS(=O)O)cc1)CCC(=O)NCCCCCCOP(=O)(O)O |
| InChI | InChI=1S/C19H31N2O8PS/c22-18(7-5-6-16-8-10-17(11-9-16)21-31(27)28)12-13-19(23)20-14-3-1-2-4-15-29-30(24,25)26/h8-11,21H,1-7,12-15H2,(H,20,23)(H,27,28)(H2,24,25,26) |
| InChIKey | AHXYTBRKSLPPSK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 162.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|