C18H31N3O7PS- — CID 155784328
1-[2-[[3-[6-[hydroxy(methoxy)phosphoryl]oxyhexylamino]-3-oxopropyl]amino]ethyl]-4-(sulfinatoamino)benzene (PubChem CID 155784328) has the molecular formula C18H31N3O7PS- and a molecular weight of 464.50 g/mol. Its IUPAC name is 1-[2-[[3-[6-[hydroxy(methoxy)phosphoryl]oxyhexylamino]-3-oxopropyl]amino]ethyl]-4-(sulfinatoamino)benzene.
| Compound Name | 1-[2-[[3-[6-[hydroxy(methoxy)phosphoryl]oxyhexylamino]-3-oxopropyl]amino]ethyl]-4-(sulfinatoamino)benzene |
|---|---|
| PubChem CID | 155784328 |
| Molecular Formula | C18H31N3O7PS- |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 1-[2-[[3-[6-[hydroxy(methoxy)phosphoryl]oxyhexylamino]-3-oxopropyl]amino]ethyl]-4-(sulfinatoamino)benzene |
| SMILES | COP(=O)(O)OCCCCCCNC(=O)CCNCCc1ccc(NS(=O)[O-])cc1 |
| InChI | InChI=1S/C18H32N3O7PS/c1-27-29(23,24)28-15-5-3-2-4-12-20-18(22)11-14-19-13-10-16-6-8-17(9-7-16)21-30(25)26/h6-9,19,21H,2-5,10-15H2,1H3,(H,20,22)(H,23,24)(H,25,26)/p-1 |
| InChIKey | XLEZUKWWIBDLBJ-UHFFFAOYSA-M |
| XLogP | 1.85 |
| TPSA | 149.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|