About dichloroiron;pentane-2,4-dione
dichloroiron;pentane-2,4-dione (PubChem CID 161133421) has the molecular formula C5H8Cl2FeO2
and a molecular weight of 226.87 g/mol. Its IUPAC name is dichloroiron;pentane-2,4-dione.
Molecular Properties
| Compound Name | dichloroiron;pentane-2,4-dione |
| PubChem CID | 161133421 |
| Molecular Formula | C5H8Cl2FeO2 |
| Molecular Weight | 226.87 g/mol |
| Exact Mass | 225.93 |
| IUPAC Name | dichloroiron;pentane-2,4-dione |
| SMILES | CC(=O)CC(C)=O.Cl[Fe]Cl |
| InChI | InChI=1S/C5H8O2.2ClH.Fe/c1-4(6)3-5(2)7;;;/h3H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | UMMKXNGFDWXCHN-UHFFFAOYSA-L |
| XLogP | 1.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.87 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichloroiron;pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroiron;pentane-2,4-dione?
The IUPAC name of dichloroiron;pentane-2,4-dione (CID 161133421) is dichloroiron;pentane-2,4-dione.
What is the SMILES notation for dichloroiron;pentane-2,4-dione?
The canonical SMILES for dichloroiron;pentane-2,4-dione is CC(=O)CC(C)=O.Cl[Fe]Cl.
What is the InChIKey of dichloroiron;pentane-2,4-dione?
The InChIKey is UMMKXNGFDWXCHN-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H8O2.2ClH.Fe/c1-4(6)3-5(2)7;;;/h3H2,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichloroiron;pentane-2,4-dione?
dichloroiron;pentane-2,4-dione has a molecular weight of 226.87 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroiron;pentane-2,4-dione is sourced from PubChem (CID 161133421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).