C28H32F4N2O9 — CID 161137529
ethyl (4R)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate;1-O-ethyl 3-O-methyl 2-[(1R)-1-(3,5-difluorophenyl)-2-nitroethyl]propanedioate;methane (PubChem CID 161137529) has the molecular formula C28H32F4N2O9 and a molecular weight of 616.56 g/mol. Its IUPAC name is ethyl (4R)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate;1-O-ethyl 3-O-methyl 2-[(1R)-1-(3,5-difluorophenyl)-2-nitroethyl]propanedioate;methane.
| Compound Name | ethyl (4R)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate;1-O-ethyl 3-O-methyl 2-[(1R)-1-(3,5-difluorophenyl)-2-nitroethyl]propanedioate;methane |
|---|---|
| PubChem CID | 161137529 |
| Molecular Formula | C28H32F4N2O9 |
| Molecular Weight | 616.56 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | ethyl (4R)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate;1-O-ethyl 3-O-methyl 2-[(1R)-1-(3,5-difluorophenyl)-2-nitroethyl]propanedioate;methane |
| SMILES | C.CCOC(=O)C(C(=O)OC)[C@@H](C[N+](=O)[O-])c1cc(F)cc(F)c1.CCOC(=O)C1C(=O)NC[C@H]1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H15F2NO6.C13H13F2NO3.CH4/c1-3-23-14(19)12(13(18)22-2)11(7-17(20)21)8-4-9(15)6-10(16)5-8;1-2-19-13(18)11-10(6-16-12(11)17)7-3-8(14)5-9(15)4-7;/h4-6,11-12H,3,7H2,1-2H3;3-5,10-11H,2,6H2,1H3,(H,16,17);1H4/t11-,12?;10-,11?;/m00./s1 |
| InChIKey | UMZKYRFFWALIJJ-NYQQIGLBSA-N |
| XLogP | 3.67 |
| TPSA | 151.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|