C32H43BrN2O4S2 — CID 161141402
2-methoxyethyl 2-[3-(benzenecarbonothioylsulfanyl)-2-(1-butylpyridin-1-ium-4-yl)propyl]-3-cyano-2,3-dimethyl-6-oxoheptanoate bromide (PubChem CID 161141402) has the molecular formula C32H43BrN2O4S2 and a molecular weight of 663.74 g/mol. Its IUPAC name is 2-methoxyethyl 2-[3-(benzenecarbonothioylsulfanyl)-2-(1-butylpyridin-1-ium-4-yl)propyl]-3-cyano-2,3-dimethyl-6-oxoheptanoate bromide.
| Compound Name | 2-methoxyethyl 2-[3-(benzenecarbonothioylsulfanyl)-2-(1-butylpyridin-1-ium-4-yl)propyl]-3-cyano-2,3-dimethyl-6-oxoheptanoate bromide |
|---|---|
| PubChem CID | 161141402 |
| Molecular Formula | C32H43BrN2O4S2 |
| Molecular Weight | 663.74 g/mol |
| Exact Mass | 662.18 |
| IUPAC Name | 2-methoxyethyl 2-[3-(benzenecarbonothioylsulfanyl)-2-(1-butylpyridin-1-ium-4-yl)propyl]-3-cyano-2,3-dimethyl-6-oxoheptanoate bromide |
| SMILES | CCCC[n+]1ccc(C(CSC(=S)c2ccccc2)CC(C)(C(=O)OCCOC)C(C)(C#N)CCC(C)=O)cc1.[Br-] |
| InChI | InChI=1S/C32H43N2O4S2.BrH/c1-6-7-17-34-18-14-26(15-19-34)28(23-40-29(39)27-11-9-8-10-12-27)22-32(4,30(36)38-21-20-37-5)31(3,24-33)16-13-25(2)35;/h8-12,14-15,18-19,28H,6-7,13,16-17,20-23H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | LSVBHBPBXREMMK-UHFFFAOYSA-M |
| XLogP | 3.46 |
| TPSA | 80.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.74 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|