C20H20FO5PS2 — CID 161162759
fluoromethanesulfonate;(4-methylsulfonylphenyl)-diphenylphosphanium (PubChem CID 161162759) has the molecular formula C20H20FO5PS2 and a molecular weight of 454.48 g/mol. Its IUPAC name is fluoromethanesulfonate;(4-methylsulfonylphenyl)-diphenylphosphanium.
| Compound Name | fluoromethanesulfonate;(4-methylsulfonylphenyl)-diphenylphosphanium |
|---|---|
| PubChem CID | 161162759 |
| Molecular Formula | C20H20FO5PS2 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | fluoromethanesulfonate;(4-methylsulfonylphenyl)-diphenylphosphanium |
| SMILES | CS(=O)(=O)c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.O=S(=O)([O-])CF |
| InChI | InChI=1S/C19H17O2PS.CH3FO3S/c1-23(20,21)19-14-12-18(13-15-19)22(16-8-4-2-5-9-16)17-10-6-3-7-11-17;2-1-6(3,4)5/h2-15H,1H3;1H2,(H,3,4,5) |
| InChIKey | UQDFYVBOBAUIPS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|