C42H35Cl2F6NO6 — CID 161190718
bis(2-[4-chloro-2-methyl-9-(trifluoromethyl)fluoren-9-yl]oxyacetic acid);(1R)-1-phenylethanamine (PubChem CID 161190718) has the molecular formula C42H35Cl2F6NO6 and a molecular weight of 834.64 g/mol. Its IUPAC name is bis(2-[4-chloro-2-methyl-9-(trifluoromethyl)fluoren-9-yl]oxyacetic acid);(1R)-1-phenylethanamine.
| Compound Name | bis(2-[4-chloro-2-methyl-9-(trifluoromethyl)fluoren-9-yl]oxyacetic acid);(1R)-1-phenylethanamine |
|---|---|
| PubChem CID | 161190718 |
| Molecular Formula | C42H35Cl2F6NO6 |
| Molecular Weight | 834.64 g/mol |
| Exact Mass | 833.17 |
| IUPAC Name | bis(2-[4-chloro-2-methyl-9-(trifluoromethyl)fluoren-9-yl]oxyacetic acid);(1R)-1-phenylethanamine |
| SMILES | C[C@@H](N)c1ccccc1.Cc1cc(Cl)c2c(c1)C(OCC(=O)O)(C(F)(F)F)c1ccccc1-2.Cc1cc(Cl)c2c(c1)C(OCC(=O)O)(C(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/2C17H12ClF3O3.C8H11N/c2*1-9-6-12-15(13(18)7-9)10-4-2-3-5-11(10)16(12,17(19,20)21)24-8-14(22)23;1-7(9)8-5-3-2-4-6-8/h2*2-7H,8H2,1H3,(H,22,23);2-7H,9H2,1H3/t;;7-/m..1/s1 |
| InChIKey | UTRKPSUACKDXAS-ATMWKJRWSA-N |
| XLogP | 10.78 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.64 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |