C41H37Cl5N2O8S — CID 161195130
1-(2-chloroethyl)naphthalene;1-(1,3-dichloropropan-2-yloxy)-2-nitrobenzene;1-[[3-(1,3-dichloropropan-2-yloxy)-2-nitrophenyl]methylsulfonyl]naphthalene (PubChem CID 161195130) has the molecular formula C41H37Cl5N2O8S and a molecular weight of 895.08 g/mol. Its IUPAC name is 1-(2-chloroethyl)naphthalene;1-(1,3-dichloropropan-2-yloxy)-2-nitrobenzene;1-[[3-(1,3-dichloropropan-2-yloxy)-2-nitrophenyl]methylsulfonyl]naphthalene.
| Compound Name | 1-(2-chloroethyl)naphthalene;1-(1,3-dichloropropan-2-yloxy)-2-nitrobenzene;1-[[3-(1,3-dichloropropan-2-yloxy)-2-nitrophenyl]methylsulfonyl]naphthalene |
|---|---|
| PubChem CID | 161195130 |
| Molecular Formula | C41H37Cl5N2O8S |
| Molecular Weight | 895.08 g/mol |
| Exact Mass | 892.07 |
| IUPAC Name | 1-(2-chloroethyl)naphthalene;1-(1,3-dichloropropan-2-yloxy)-2-nitrobenzene;1-[[3-(1,3-dichloropropan-2-yloxy)-2-nitrophenyl]methylsulfonyl]naphthalene |
| SMILES | ClCCc1cccc2ccccc12.O=[N+]([O-])c1c(CS(=O)(=O)c2cccc3ccccc23)cccc1OC(CCl)CCl.O=[N+]([O-])c1ccccc1OC(CCl)CCl |
| InChI | InChI=1S/C20H17Cl2NO5S.C12H11Cl.C9H9Cl2NO3/c21-11-16(12-22)28-18-9-3-7-15(20(18)23(24)25)13-29(26,27)19-10-4-6-14-5-1-2-8-17(14)19;13-9-8-11-6-3-5-10-4-1-2-7-12(10)11;10-5-7(6-11)15-9-4-2-1-3-8(9)12(13)14/h1-10,16H,11-13H2;1-7H,8-9H2;1-4,7H,5-6H2 |
| InChIKey | UUFWEEAGXBWSQA-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.08 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|