C20H23BiS2Si — CID 161230223
trimethyl-(5,9,10-trimethyl-7-phenyl-3,11-dithia-7-bismatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)silane (PubChem CID 161230223) has the molecular formula C20H23BiS2Si and a molecular weight of 564.60 g/mol. Its IUPAC name is trimethyl-(5,9,10-trimethyl-7-phenyl-3,11-dithia-7-bismatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)silane.
| Compound Name | trimethyl-(5,9,10-trimethyl-7-phenyl-3,11-dithia-7-bismatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)silane |
|---|---|
| PubChem CID | 161230223 |
| Molecular Formula | C20H23BiS2Si |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.08 |
| IUPAC Name | trimethyl-(5,9,10-trimethyl-7-phenyl-3,11-dithia-7-bismatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)silane |
| SMILES | Cc1sc2c(c1C)[Bi](c1ccccc1)c1c-2sc([Si](C)(C)C)c1C |
| InChI | InChI=1S/C14H18S2Si.C6H5.Bi/c1-9-7-12(15-11(9)3)13-8-10(2)14(16-13)17(4,5)6;1-2-4-6-5-3-1;/h1-6H3;1-5H; |
| InChIKey | VEMORBHZZLLRDS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|