C18H13BiS — CID 140603927
10-phenylbenzo[b][1,4]benzothiabismine (PubChem CID 140603927) has the molecular formula C18H13BiS and a molecular weight of 470.35 g/mol. Its IUPAC name is 10-phenylbenzo[b][1,4]benzothiabismine.
| Compound Name | 10-phenylbenzo[b][1,4]benzothiabismine |
|---|---|
| PubChem CID | 140603927 |
| Molecular Formula | C18H13BiS |
| Molecular Weight | 470.35 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 10-phenylbenzo[b][1,4]benzothiabismine |
| SMILES | c1ccc([Bi]2c3ccccc3Sc3ccccc32)cc1 |
| InChI | InChI=1S/C12H8S.C6H5.Bi/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-4-6-5-3-1;/h1-7,9H;1-5H; |
| InChIKey | FNSRUDWCDWFTAR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |