C33H35BBr2N2O6S2 — CID 161247791
4-bromo-1H-indene;4-bromo-1-methylsulfonylindole;1-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 161247791) has the molecular formula C33H35BBr2N2O6S2 and a molecular weight of 790.41 g/mol. Its IUPAC name is 4-bromo-1H-indene;4-bromo-1-methylsulfonylindole;1-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 4-bromo-1H-indene;4-bromo-1-methylsulfonylindole;1-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 161247791 |
| Molecular Formula | C33H35BBr2N2O6S2 |
| Molecular Weight | 790.41 g/mol |
| Exact Mass | 788.04 |
| IUPAC Name | 4-bromo-1H-indene;4-bromo-1-methylsulfonylindole;1-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | Brc1cccc2c1C=CC2.CC1(C)OB(c2cccc3c2ccn3S(C)(=O)=O)OC1(C)C.CS(=O)(=O)n1ccc2c(Br)cccc21 |
| InChI | InChI=1S/C15H20BNO4S.C9H8BrNO2S.C9H7Br/c1-14(2)15(3,4)21-16(20-14)12-7-6-8-13-11(12)9-10-17(13)22(5,18)19;1-14(12,13)11-6-5-7-8(10)3-2-4-9(7)11;10-9-6-2-4-7-3-1-5-8(7)9/h6-10H,1-5H3;2-6H,1H3;1-2,4-6H,3H2 |
| InChIKey | VAWCSNCKYKSCPN-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.41 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|