C28H49ClO11 — CID 161280477
2-[2-(2-hydroxypropoxy)ethoxy]propan-1-ol;2-methylprop-2-enoyl chloride;2-[2-[2-(2-methylprop-2-enoyloxy)propoxy]ethoxy]propyl 2-methylprop-2-enoate (PubChem CID 161280477) has the molecular formula C28H49ClO11 and a molecular weight of 597.14 g/mol. Its IUPAC name is 2-[2-(2-hydroxypropoxy)ethoxy]propan-1-ol;2-methylprop-2-enoyl chloride;2-[2-[2-(2-methylprop-2-enoyloxy)propoxy]ethoxy]propyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-(2-hydroxypropoxy)ethoxy]propan-1-ol;2-methylprop-2-enoyl chloride;2-[2-[2-(2-methylprop-2-enoyloxy)propoxy]ethoxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 161280477 |
| Molecular Formula | C28H49ClO11 |
| Molecular Weight | 597.14 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | 2-[2-(2-hydroxypropoxy)ethoxy]propan-1-ol;2-methylprop-2-enoyl chloride;2-[2-[2-(2-methylprop-2-enoyloxy)propoxy]ethoxy]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Cl.C=C(C)C(=O)OCC(C)OCCOCC(C)OC(=O)C(=C)C.CC(O)COCCOC(C)CO |
| InChI | InChI=1S/C16H26O6.C8H18O4.C4H5ClO/c1-11(2)15(17)21-10-13(5)20-8-7-19-9-14(6)22-16(18)12(3)4;1-7(10)6-11-3-4-12-8(2)5-9;1-3(2)4(5)6/h13-14H,1,3,7-10H2,2,4-6H3;7-10H,3-6H2,1-2H3;1H2,2H3 |
| InChIKey | VFAACTUONUFFLI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 147.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.14 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|