C24H24O7-2 — CID 161315321
6,7-dihydroxy-4-methyl-1H-naphthalen-2-one;6,7-dimethoxy-4-methyl-1H-naphthalen-2-one;oxygen(2-) (PubChem CID 161315321) has the molecular formula C24H24O7-2 and a molecular weight of 424.45 g/mol. Its IUPAC name is 6,7-dihydroxy-4-methyl-1H-naphthalen-2-one;6,7-dimethoxy-4-methyl-1H-naphthalen-2-one;oxygen(2-).
| Compound Name | 6,7-dihydroxy-4-methyl-1H-naphthalen-2-one;6,7-dimethoxy-4-methyl-1H-naphthalen-2-one;oxygen(2-) |
|---|---|
| PubChem CID | 161315321 |
| Molecular Formula | C24H24O7-2 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 6,7-dihydroxy-4-methyl-1H-naphthalen-2-one;6,7-dimethoxy-4-methyl-1H-naphthalen-2-one;oxygen(2-) |
| SMILES | CC1=CC(=O)Cc2cc(O)c(O)cc21.COc1cc2c(cc1OC)C(C)=CC(=O)C2.[O-2] |
| InChI | InChI=1S/C13H14O3.C11H10O3.O/c1-8-4-10(14)5-9-6-12(15-2)13(16-3)7-11(8)9;1-6-2-8(12)3-7-4-10(13)11(14)5-9(6)7;/h4,6-7H,5H2,1-3H3;2,4-5,13-14H,3H2,1H3;/q;;-2 |
| InChIKey | AAUZVLKRRCACJB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 121.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|