About CID 161336394
CID 161336394 (PubChem CID 161336394) has the molecular formula C18H35O5Sn
and a molecular weight of 450.18 g/mol.
Molecular Properties
| Compound Name | CID 161336394 |
| PubChem CID | 161336394 |
| Molecular Formula | C18H35O5Sn |
| Molecular Weight | 450.18 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | — |
| SMILES | CCOOC(=O)C(CC)CCCCCCCC(=O)[O-].CC[Sn+]CC |
| InChI | InChI=1S/C14H26O5.2C2H5.Sn/c1-3-12(14(17)19-18-4-2)10-8-6-5-7-9-11-13(15)16;2*1-2;/h12H,3-11H2,1-2H3,(H,15,16);2*1H2,2H3;/q;;;+1/p-1 |
| InChIKey | VMCADOHONDZECW-UHFFFAOYSA-M |
| XLogP | 3.55 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.18 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 161336394 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161336394?
The IUPAC name of CID 161336394 (CID 161336394) is not available.
What is the SMILES notation for CID 161336394?
The canonical SMILES for CID 161336394 is CCOOC(=O)C(CC)CCCCCCCC(=O)[O-].CC[Sn+]CC.
What is the InChIKey of CID 161336394?
The InChIKey is VMCADOHONDZECW-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H26O5.2C2H5.Sn/c1-3-12(14(17)19-18-4-2)10-8-6-5-7-9-11-13(15)16;2*1-2;/h12H,3-11H2,1-2H3,(H,15,16);2*1H2,2H3;/q;;;+1/p-1.
What are the key properties of CID 161336394?
CID 161336394 has a molecular weight of 450.18 g/mol, XLogP of 3.55, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161336394 is sourced from PubChem (CID 161336394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).