C24H48O3S3 — CID 161351833
4-tert-butylthiane 1-oxide;3-tert-butylthietane 1-oxide;3-tert-butylthiolane 1-oxide (PubChem CID 161351833) has the molecular formula C24H48O3S3 and a molecular weight of 480.85 g/mol. Its IUPAC name is 4-tert-butylthiane 1-oxide;3-tert-butylthietane 1-oxide;3-tert-butylthiolane 1-oxide.
| Compound Name | 4-tert-butylthiane 1-oxide;3-tert-butylthietane 1-oxide;3-tert-butylthiolane 1-oxide |
|---|---|
| PubChem CID | 161351833 |
| Molecular Formula | C24H48O3S3 |
| Molecular Weight | 480.85 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | 4-tert-butylthiane 1-oxide;3-tert-butylthietane 1-oxide;3-tert-butylthiolane 1-oxide |
| SMILES | CC(C)(C)C1CCS(=O)C1.CC(C)(C)C1CCS(=O)CC1.CC(C)(C)C1CS(=O)C1 |
| InChI | InChI=1S/C9H18OS.C8H16OS.C7H14OS/c1-9(2,3)8-4-6-11(10)7-5-8;1-8(2,3)7-4-5-10(9)6-7;1-7(2,3)6-4-9(8)5-6/h8H,4-7H2,1-3H3;7H,4-6H2,1-3H3;6H,4-5H2,1-3H3 |
| InChIKey | VOAIMCVCNPDOIU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.85 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |