About ethylazanium;[2-(methylamino)-2-oxoethyl]azanium;dichloride
ethylazanium;[2-(methylamino)-2-oxoethyl]azanium;dichloride (PubChem CID 161353127) has the molecular formula C5H17Cl2N3O
and a molecular weight of 206.12 g/mol. Its IUPAC name is ethylazanium;[2-(methylamino)-2-oxoethyl]azanium;dichloride.
Molecular Properties
| Compound Name | ethylazanium;[2-(methylamino)-2-oxoethyl]azanium;dichloride |
| PubChem CID | 161353127 |
| Molecular Formula | C5H17Cl2N3O |
| Molecular Weight | 206.12 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | ethylazanium;[2-(methylamino)-2-oxoethyl]azanium;dichloride |
| SMILES | CC[NH3+].CNC(=O)C[NH3+].[Cl-].[Cl-] |
| InChI | InChI=1S/C3H8N2O.C2H7N.2ClH/c1-5-3(6)2-4;1-2-3;;/h2,4H2,1H3,(H,5,6);2-3H2,1H3;2*1H |
| InChIKey | PTWHODWRJWCIOM-UHFFFAOYSA-N |
| XLogP | -8.77 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.12 |
| LogP ≤ 5 | -8.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethylazanium;[2-(methylamino)-2-oxoethyl]azanium;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylazanium;[2-(methylamino)-2-oxoethyl]azanium;dichloride?
The IUPAC name of ethylazanium;[2-(methylamino)-2-oxoethyl]azanium;dichloride (CID 161353127) is ethylazanium;[2-(methylamino)-2-oxoethyl]azanium;dichloride.
What is the SMILES notation for ethylazanium;[2-(methylamino)-2-oxoethyl]azanium;dichloride?
The canonical SMILES for ethylazanium;[2-(methylamino)-2-oxoethyl]azanium;dichloride is CC[NH3+].CNC(=O)C[NH3+].[Cl-].[Cl-].
What is the InChIKey of ethylazanium;[2-(methylamino)-2-oxoethyl]azanium;dichloride?
The InChIKey is PTWHODWRJWCIOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O.C2H7N.2ClH/c1-5-3(6)2-4;1-2-3;;/h2,4H2,1H3,(H,5,6);2-3H2,1H3;2*1H.
What are the key properties of ethylazanium;[2-(methylamino)-2-oxoethyl]azanium;dichloride?
ethylazanium;[2-(methylamino)-2-oxoethyl]azanium;dichloride has a molecular weight of 206.12 g/mol, XLogP of -8.77, 1 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylazanium;[2-(methylamino)-2-oxoethyl]azanium;dichloride is sourced from PubChem (CID 161353127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).