C28H43FN7O5+ — CID 161357860
butanedioic acid;6-N-(cyclohexylmethyl)-4-N-[(1-ethylpyrrolidin-1-ium-2-yl)methyl]-2-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 161357860) has the molecular formula C28H43FN7O5+ and a molecular weight of 576.69 g/mol. Its IUPAC name is butanedioic acid;6-N-(cyclohexylmethyl)-4-N-[(1-ethylpyrrolidin-1-ium-2-yl)methyl]-2-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | butanedioic acid;6-N-(cyclohexylmethyl)-4-N-[(1-ethylpyrrolidin-1-ium-2-yl)methyl]-2-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 161357860 |
| Molecular Formula | C28H43FN7O5+ |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | butanedioic acid;6-N-(cyclohexylmethyl)-4-N-[(1-ethylpyrrolidin-1-ium-2-yl)methyl]-2-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC[NH+]1CCCC1CNc1nc(NCC2CCCCC2)nc(Nc2ccc(OC)c(F)c2)n1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C24H36FN7O.C4H6O4/c1-3-32-13-7-10-19(32)16-27-23-29-22(26-15-17-8-5-4-6-9-17)30-24(31-23)28-18-11-12-21(33-2)20(25)14-18;5-3(6)1-2-4(7)8/h11-12,14,17,19H,3-10,13,15-16H2,1-2H3,(H3,26,27,28,29,30,31);1-2H2,(H,5,6)(H,7,8)/p+1 |
| InChIKey | VOTXZOGYXITDOH-UHFFFAOYSA-O |
| XLogP | 3.17 |
| TPSA | 163.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |