C20H18N6OS2 — CID 161387525
2-amino-4-phenyl-1,3-thiazole-5-carbonitrile;3-oxo-3-phenylpropanenitrile;thiourea (PubChem CID 161387525) has the molecular formula C20H18N6OS2 and a molecular weight of 422.54 g/mol. Its IUPAC name is 2-amino-4-phenyl-1,3-thiazole-5-carbonitrile;3-oxo-3-phenylpropanenitrile;thiourea.
| Compound Name | 2-amino-4-phenyl-1,3-thiazole-5-carbonitrile;3-oxo-3-phenylpropanenitrile;thiourea |
|---|---|
| PubChem CID | 161387525 |
| Molecular Formula | C20H18N6OS2 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 2-amino-4-phenyl-1,3-thiazole-5-carbonitrile;3-oxo-3-phenylpropanenitrile;thiourea |
| SMILES | N#CCC(=O)c1ccccc1.N#Cc1sc(N)nc1-c1ccccc1.NC(N)=S |
| InChI | InChI=1S/C10H7N3S.C9H7NO.CH4N2S/c11-6-8-9(13-10(12)14-8)7-4-2-1-3-5-7;10-7-6-9(11)8-4-2-1-3-5-8;2-1(3)4/h1-5H,(H2,12,13);1-5H,6H2;(H4,2,3,4) |
| InChIKey | VSNXHPULOBXDOB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|