C65H46N6O2 — CID 165043683
2,6-diphenyl-4-[4-(N-phenylanilino)phenyl]pyridine-3,5-dicarbonitrile;3-oxo-3-phenylpropanenitrile;4-(N-phenylanilino)benzaldehyde (PubChem CID 165043683) has the molecular formula C65H46N6O2 and a molecular weight of 943.12 g/mol. Its IUPAC name is 2,6-diphenyl-4-[4-(N-phenylanilino)phenyl]pyridine-3,5-dicarbonitrile;3-oxo-3-phenylpropanenitrile;4-(N-phenylanilino)benzaldehyde.
| Compound Name | 2,6-diphenyl-4-[4-(N-phenylanilino)phenyl]pyridine-3,5-dicarbonitrile;3-oxo-3-phenylpropanenitrile;4-(N-phenylanilino)benzaldehyde |
|---|---|
| PubChem CID | 165043683 |
| Molecular Formula | C65H46N6O2 |
| Molecular Weight | 943.12 g/mol |
| Exact Mass | 942.37 |
| IUPAC Name | 2,6-diphenyl-4-[4-(N-phenylanilino)phenyl]pyridine-3,5-dicarbonitrile;3-oxo-3-phenylpropanenitrile;4-(N-phenylanilino)benzaldehyde |
| SMILES | N#CCC(=O)c1ccccc1.N#Cc1c(-c2ccccc2)nc(-c2ccccc2)c(C#N)c1-c1ccc(N(c2ccccc2)c2ccccc2)cc1.O=Cc1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H24N4.C19H15NO.C9H7NO/c38-25-33-35(34(26-39)37(29-15-7-2-8-16-29)40-36(33)28-13-5-1-6-14-28)27-21-23-32(24-22-27)41(30-17-9-3-10-18-30)31-19-11-4-12-20-31;21-15-16-11-13-19(14-12-16)20(17-7-3-1-4-8-17)18-9-5-2-6-10-18;10-7-6-9(11)8-4-2-1-3-5-8/h1-24H;1-15H;1-5H,6H2 |
| InChIKey | ONTJYCATCSWMPM-UHFFFAOYSA-N |
| XLogP | 16.05 |
| TPSA | 124.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.12 |
| LogP ≤ 5 | 16.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|