C21H13AgClF3N3OS2 — CID 161399691
1-[5-(1,3-benzothiazol-2-yl)-3-chloro-2-hydroxyphenyl]-3-[2-(trifluoromethyl)phenyl]thiourea;silver (PubChem CID 161399691) has the molecular formula C21H13AgClF3N3OS2 and a molecular weight of 587.80 g/mol. Its IUPAC name is 1-[5-(1,3-benzothiazol-2-yl)-3-chloro-2-hydroxyphenyl]-3-[2-(trifluoromethyl)phenyl]thiourea;silver.
| Compound Name | 1-[5-(1,3-benzothiazol-2-yl)-3-chloro-2-hydroxyphenyl]-3-[2-(trifluoromethyl)phenyl]thiourea;silver |
|---|---|
| PubChem CID | 161399691 |
| Molecular Formula | C21H13AgClF3N3OS2 |
| Molecular Weight | 587.80 g/mol |
| Exact Mass | 585.92 |
| IUPAC Name | 1-[5-(1,3-benzothiazol-2-yl)-3-chloro-2-hydroxyphenyl]-3-[2-(trifluoromethyl)phenyl]thiourea;silver |
| SMILES | Oc1c(Cl)cc(-c2nc3ccccc3s2)cc1NC(=S)Nc1ccccc1C(F)(F)F.[Ag] |
| InChI | InChI=1S/C21H13ClF3N3OS2.Ag/c22-13-9-11(19-26-15-7-3-4-8-17(15)31-19)10-16(18(13)29)28-20(30)27-14-6-2-1-5-12(14)21(23,24)25;/h1-10,29H,(H2,27,28,30); |
| InChIKey | VUBLHIAXPZXLNZ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.80 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|