C34H37F3O6S3 — CID 161401643
diphenyl-[4-(trifluoromethylsulfonyloxy)phenyl]sulfanium;2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 161401643) has the molecular formula C34H37F3O6S3 and a molecular weight of 694.86 g/mol. Its IUPAC name is diphenyl-[4-(trifluoromethylsulfonyloxy)phenyl]sulfanium;2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | diphenyl-[4-(trifluoromethylsulfonyloxy)phenyl]sulfanium;2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 161401643 |
| Molecular Formula | C34H37F3O6S3 |
| Molecular Weight | 694.86 g/mol |
| Exact Mass | 694.17 |
| IUPAC Name | diphenyl-[4-(trifluoromethylsulfonyloxy)phenyl]sulfanium;2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)[O-])c(C(C)C)c1.O=S(=O)(Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C19H14F3O3S2.C15H24O3S/c20-19(21,22)27(23,24)25-15-11-13-18(14-12-15)26(16-7-3-1-4-8-16)17-9-5-2-6-10-17;1-9(2)12-7-13(10(3)4)15(19(16,17)18)14(8-12)11(5)6/h1-14H;7-11H,1-6H3,(H,16,17,18)/q+1;/p-1 |
| InChIKey | VUHSDCARXBWYHF-UHFFFAOYSA-M |
| XLogP | 8.97 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.86 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|