C49H76O4 — CID 161406236
1,3-bis(2,4-ditert-butyl-6-methylphenyl)-1-(2,4-ditert-butylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol (PubChem CID 161406236) has the molecular formula C49H76O4 and a molecular weight of 729.14 g/mol. Its IUPAC name is 1,3-bis(2,4-ditert-butyl-6-methylphenyl)-1-(2,4-ditert-butylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol.
| Compound Name | 1,3-bis(2,4-ditert-butyl-6-methylphenyl)-1-(2,4-ditert-butylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 161406236 |
| Molecular Formula | C49H76O4 |
| Molecular Weight | 729.14 g/mol |
| Exact Mass | 728.57 |
| IUPAC Name | 1,3-bis(2,4-ditert-butyl-6-methylphenyl)-1-(2,4-ditert-butylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol |
| SMILES | Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1C(O)C(CO)(CO)C(O)(c1ccc(C(C)(C)C)cc1C(C)(C)C)c1c(C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C49H76O4/c1-30-23-33(43(6,7)8)26-37(46(15,16)17)39(30)41(52)48(28-50,29-51)49(53,35-22-21-32(42(3,4)5)25-36(35)45(12,13)14)40-31(2)24-34(44(9,10)11)27-38(40)47(18,19)20/h21-27,41,50-53H,28-29H2,1-20H3 |
| InChIKey | OLTASFPLTGLHCW-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.14 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |