C50H78O4 — CID 175744426
1,1,3-tris(2,4-ditert-butyl-6-methylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol (PubChem CID 175744426) has the molecular formula C50H78O4 and a molecular weight of 743.17 g/mol. Its IUPAC name is 1,1,3-tris(2,4-ditert-butyl-6-methylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol.
| Compound Name | 1,1,3-tris(2,4-ditert-butyl-6-methylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 175744426 |
| Molecular Formula | C50H78O4 |
| Molecular Weight | 743.17 g/mol |
| Exact Mass | 742.59 |
| IUPAC Name | 1,1,3-tris(2,4-ditert-butyl-6-methylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol |
| SMILES | Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1C(O)C(CO)(CO)C(O)(c1c(C)cc(C(C)(C)C)cc1C(C)(C)C)c1c(C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C50H78O4/c1-30-22-33(43(4,5)6)25-36(46(13,14)15)39(30)42(53)49(28-51,29-52)50(54,40-31(2)23-34(44(7,8)9)26-37(40)47(16,17)18)41-32(3)24-35(45(10,11)12)27-38(41)48(19,20)21/h22-27,42,51-54H,28-29H2,1-21H3 |
| InChIKey | YKNQMBDZISNUJO-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.17 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |