C34H41N7O3 — CID 161423631
N'-[4-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)butyl]-2-[3-(1H-indol-3-ylmethyl)-2-oxopentyl]butanediamide (PubChem CID 161423631) has the molecular formula C34H41N7O3 and a molecular weight of 595.75 g/mol. Its IUPAC name is N'-[4-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)butyl]-2-[3-(1H-indol-3-ylmethyl)-2-oxopentyl]butanediamide.
| Compound Name | N'-[4-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)butyl]-2-[3-(1H-indol-3-ylmethyl)-2-oxopentyl]butanediamide |
|---|---|
| PubChem CID | 161423631 |
| Molecular Formula | C34H41N7O3 |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | N'-[4-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)butyl]-2-[3-(1H-indol-3-ylmethyl)-2-oxopentyl]butanediamide |
| SMILES | CCc1nc2c(N)nc3ccccc3c2n1CCCCNC(=O)CC(CC(=O)C(CC)Cc1c[nH]c2ccccc12)C(N)=O |
| InChI | InChI=1S/C34H41N7O3/c1-3-21(17-23-20-38-26-13-7-5-11-24(23)26)28(42)18-22(34(36)44)19-30(43)37-15-9-10-16-41-29(4-2)40-31-32(41)25-12-6-8-14-27(25)39-33(31)35/h5-8,11-14,20-22,38H,3-4,9-10,15-19H2,1-2H3,(H2,35,39)(H2,36,44)(H,37,43) |
| InChIKey | VXBIHBLXDBJRHH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 161.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|