C64H74O4 — CID 161425936
2-dec-1-enylcyclopentan-1-one;2-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentan-1-one;naphthalen-1-yl(phenyl)methanone;naphthalen-2-yl(phenyl)methanone (PubChem CID 161425936) has the molecular formula C64H74O4 and a molecular weight of 907.29 g/mol. Its IUPAC name is 2-dec-1-enylcyclopentan-1-one;2-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentan-1-one;naphthalen-1-yl(phenyl)methanone;naphthalen-2-yl(phenyl)methanone.
| Compound Name | 2-dec-1-enylcyclopentan-1-one;2-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentan-1-one;naphthalen-1-yl(phenyl)methanone;naphthalen-2-yl(phenyl)methanone |
|---|---|
| PubChem CID | 161425936 |
| Molecular Formula | C64H74O4 |
| Molecular Weight | 907.29 g/mol |
| Exact Mass | 906.56 |
| IUPAC Name | 2-dec-1-enylcyclopentan-1-one;2-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentan-1-one;naphthalen-1-yl(phenyl)methanone;naphthalen-2-yl(phenyl)methanone |
| SMILES | CC(C)=CCC/C(C)=C/CC1CCCC1=O.CCCCCCCCC=CC1CCCC1=O.O=C(c1ccccc1)c1ccc2ccccc2c1.O=C(c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/2C17H12O.C15H24O.C15H26O/c18-17(14-8-2-1-3-9-14)16-12-6-10-13-7-4-5-11-15(13)16;18-17(14-7-2-1-3-8-14)16-11-10-13-6-4-5-9-15(13)12-16;1-12(2)6-4-7-13(3)10-11-14-8-5-9-15(14)16;1-2-3-4-5-6-7-8-9-11-14-12-10-13-15(14)16/h2*1-12H;6,10,14H,4-5,7-9,11H2,1-3H3;9,11,14H,2-8,10,12-13H2,1H3/b;;13-10+; |
| InChIKey | VXIYJBMYMXHMDA-MDXHUEHBSA-N |
| XLogP | 17.24 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.29 |
| LogP ≤ 5 | 17.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|