C14H13N5O2S — CID 161435205
[4-(pyrido[2,3-d]pyrimidin-4-ylamino)phenyl]methanesulfonamide (PubChem CID 161435205) has the molecular formula C14H13N5O2S and a molecular weight of 315.36 g/mol. Its IUPAC name is [4-(pyrido[2,3-d]pyrimidin-4-ylamino)phenyl]methanesulfonamide.
| Compound Name | [4-(pyrido[2,3-d]pyrimidin-4-ylamino)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 161435205 |
| Molecular Formula | C14H13N5O2S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | [4-(pyrido[2,3-d]pyrimidin-4-ylamino)phenyl]methanesulfonamide |
| SMILES | NS(=O)(=O)Cc1ccc(Nc2ncnc3ncccc23)cc1 |
| InChI | InChI=1S/C14H13N5O2S/c15-22(20,21)8-10-3-5-11(6-4-10)19-14-12-2-1-7-16-13(12)17-9-18-14/h1-7,9H,8H2,(H2,15,20,21)(H,16,17,18,19) |
| InChIKey | VYOAHUMHBGJRPH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |