C26H36O7 — CID 161445179
2-(2-methylpentan-2-yl)benzenecarboperoxoic acid;2-methylpentan-2-yloxy benzenecarboperoxoate (PubChem CID 161445179) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is 2-(2-methylpentan-2-yl)benzenecarboperoxoic acid;2-methylpentan-2-yloxy benzenecarboperoxoate.
| Compound Name | 2-(2-methylpentan-2-yl)benzenecarboperoxoic acid;2-methylpentan-2-yloxy benzenecarboperoxoate |
|---|---|
| PubChem CID | 161445179 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 2-(2-methylpentan-2-yl)benzenecarboperoxoic acid;2-methylpentan-2-yloxy benzenecarboperoxoate |
| SMILES | CCCC(C)(C)OOOC(=O)c1ccccc1.CCCC(C)(C)c1ccccc1C(=O)OO |
| InChI | InChI=1S/C13H18O4.C13H18O3/c1-4-10-13(2,3)16-17-15-12(14)11-8-6-5-7-9-11;1-4-9-13(2,3)11-8-6-5-7-10(11)12(14)16-15/h5-9H,4,10H2,1-3H3;5-8,15H,4,9H2,1-3H3 |
| InChIKey | VZUKCEQHZOLOHP-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|