C37H40N8O6S2 — CID 161483282
O-[4-[3-amino-5-(4-methylphenyl)pyrazol-1-yl]phenyl]sulfanyloxyhydroxylamine;tert-butyl N-[1-(4-aminoperoxysulfanylphenyl)-5-(4-methylphenyl)pyrazol-3-yl]carbamate (PubChem CID 161483282) has the molecular formula C37H40N8O6S2 and a molecular weight of 756.91 g/mol. Its IUPAC name is O-[4-[3-amino-5-(4-methylphenyl)pyrazol-1-yl]phenyl]sulfanyloxyhydroxylamine;tert-butyl N-[1-(4-aminoperoxysulfanylphenyl)-5-(4-methylphenyl)pyrazol-3-yl]carbamate.
| Compound Name | O-[4-[3-amino-5-(4-methylphenyl)pyrazol-1-yl]phenyl]sulfanyloxyhydroxylamine;tert-butyl N-[1-(4-aminoperoxysulfanylphenyl)-5-(4-methylphenyl)pyrazol-3-yl]carbamate |
|---|---|
| PubChem CID | 161483282 |
| Molecular Formula | C37H40N8O6S2 |
| Molecular Weight | 756.91 g/mol |
| Exact Mass | 756.25 |
| IUPAC Name | O-[4-[3-amino-5-(4-methylphenyl)pyrazol-1-yl]phenyl]sulfanyloxyhydroxylamine;tert-butyl N-[1-(4-aminoperoxysulfanylphenyl)-5-(4-methylphenyl)pyrazol-3-yl]carbamate |
| SMILES | Cc1ccc(-c2cc(N)nn2-c2ccc(SOON)cc2)cc1.Cc1ccc(-c2cc(NC(=O)OC(C)(C)C)nn2-c2ccc(SOON)cc2)cc1 |
| InChI | InChI=1S/C21H24N4O4S.C16H16N4O2S/c1-14-5-7-15(8-6-14)18-13-19(23-20(26)27-21(2,3)4)24-25(18)16-9-11-17(12-10-16)30-29-28-22;1-11-2-4-12(5-3-11)15-10-16(17)19-20(15)13-6-8-14(9-7-13)23-22-21-18/h5-13H,22H2,1-4H3,(H,23,24,26);2-10H,18H2,1H3,(H2,17,19) |
| InChIKey | WEQKWCQKQQTKTG-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 188.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.91 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|