C12H12ClF2NO — CID 161495198
5-chloro-6-(2,2-difluoroethoxy)-1-ethylindole (PubChem CID 161495198) has the molecular formula C12H12ClF2NO and a molecular weight of 259.68 g/mol. Its IUPAC name is 5-chloro-6-(2,2-difluoroethoxy)-1-ethylindole.
| Compound Name | 5-chloro-6-(2,2-difluoroethoxy)-1-ethylindole |
|---|---|
| PubChem CID | 161495198 |
| Molecular Formula | C12H12ClF2NO |
| Molecular Weight | 259.68 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 5-chloro-6-(2,2-difluoroethoxy)-1-ethylindole |
| SMILES | CCn1ccc2cc(Cl)c(OCC(F)F)cc21 |
| InChI | InChI=1S/C12H12ClF2NO/c1-2-16-4-3-8-5-9(13)11(6-10(8)16)17-7-12(14)15/h3-6,12H,2,7H2,1H3 |
| InChIKey | WGCJPWXGKOPBDR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.68 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |