About bis(methyl 3-(ethylcarbamoyloxy)propanoate);tricyclo[5.2.1.02,6]decane
bis(methyl 3-(ethylcarbamoyloxy)propanoate);tricyclo[5.2.1.02,6]decane (PubChem CID 162020092) has the molecular formula C24H42N2O8
and a molecular weight of 486.61 g/mol. Its IUPAC name is bis(methyl 3-(ethylcarbamoyloxy)propanoate);tricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | bis(methyl 3-(ethylcarbamoyloxy)propanoate);tricyclo[5.2.1.02,6]decane |
| PubChem CID | 162020092 |
| Molecular Formula | C24H42N2O8 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | bis(methyl 3-(ethylcarbamoyloxy)propanoate);tricyclo[5.2.1.02,6]decane |
| SMILES | C1CC2C3CCC(C3)C2C1.CCNC(=O)OCCC(=O)OC.CCNC(=O)OCCC(=O)OC |
| InChI | InChI=1S/C10H16.2C7H13NO4/c1-2-9-7-4-5-8(6-7)10(9)3-1;2*1-3-8-7(10)12-5-4-6(9)11-2/h7-10H,1-6H2;2*3-5H2,1-2H3,(H,8,10) |
| InChIKey | YUQHMSLEPQNXTJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze bis(methyl 3-(ethylcarbamoyloxy)propanoate);tricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(methyl 3-(ethylcarbamoyloxy)propanoate);tricyclo[5.2.1.02,6]decane?
The IUPAC name of bis(methyl 3-(ethylcarbamoyloxy)propanoate);tricyclo[5.2.1.02,6]decane (CID 162020092) is bis(methyl 3-(ethylcarbamoyloxy)propanoate);tricyclo[5.2.1.02,6]decane.
What is the SMILES notation for bis(methyl 3-(ethylcarbamoyloxy)propanoate);tricyclo[5.2.1.02,6]decane?
The canonical SMILES for bis(methyl 3-(ethylcarbamoyloxy)propanoate);tricyclo[5.2.1.02,6]decane is C1CC2C3CCC(C3)C2C1.CCNC(=O)OCCC(=O)OC.CCNC(=O)OCCC(=O)OC.
What is the InChIKey of bis(methyl 3-(ethylcarbamoyloxy)propanoate);tricyclo[5.2.1.02,6]decane?
The InChIKey is YUQHMSLEPQNXTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.2C7H13NO4/c1-2-9-7-4-5-8(6-7)10(9)3-1;2*1-3-8-7(10)12-5-4-6(9)11-2/h7-10H,1-6H2;2*3-5H2,1-2H3,(H,8,10).
What are the key properties of bis(methyl 3-(ethylcarbamoyloxy)propanoate);tricyclo[5.2.1.02,6]decane?
bis(methyl 3-(ethylcarbamoyloxy)propanoate);tricyclo[5.2.1.02,6]decane has a molecular weight of 486.61 g/mol, XLogP of 3.42, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(methyl 3-(ethylcarbamoyloxy)propanoate);tricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 162020092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).