C42H64N4O12 — CID 161381321
bis([3-[ethyl-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyl]amino]-3-oxopropyl] 2-methylprop-2-enoate);tricyclo[5.2.1.02,6]decane (PubChem CID 161381321) has the molecular formula C42H64N4O12 and a molecular weight of 816.99 g/mol. Its IUPAC name is bis([3-[ethyl-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyl]amino]-3-oxopropyl] 2-methylprop-2-enoate);tricyclo[5.2.1.02,6]decane.
| Compound Name | bis([3-[ethyl-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyl]amino]-3-oxopropyl] 2-methylprop-2-enoate);tricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 161381321 |
| Molecular Formula | C42H64N4O12 |
| Molecular Weight | 816.99 g/mol |
| Exact Mass | 816.45 |
| IUPAC Name | bis([3-[ethyl-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyl]amino]-3-oxopropyl] 2-methylprop-2-enoate);tricyclo[5.2.1.02,6]decane |
| SMILES | C1CC2C3CCC(C3)C2C1.C=C(C)C(=O)OCCNC(=O)N(CC)C(=O)CCOC(=O)C(=C)C.C=C(C)C(=O)OCCNC(=O)N(CC)C(=O)CCOC(=O)C(=C)C |
| InChI | InChI=1S/2C16H24N2O6.C10H16/c2*1-6-18(13(19)7-9-23-14(20)11(2)3)16(22)17-8-10-24-15(21)12(4)5;1-2-9-7-4-5-8(6-7)10(9)3-1/h2*2,4,6-10H2,1,3,5H3,(H,17,22);7-10H,1-6H2 |
| InChIKey | VRTJWEBMGRXZAO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 204.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.99 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|