C23H37NO6 — CID 58152920
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl 6-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]hexanoate (PubChem CID 58152920) has the molecular formula C23H37NO6 and a molecular weight of 423.55 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl 6-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]hexanoate.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl 6-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]hexanoate |
|---|---|
| PubChem CID | 58152920 |
| Molecular Formula | C23H37NO6 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl 6-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]hexanoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCCCCC(=O)OC1CCC2CCCCC2C1 |
| InChI | InChI=1S/C23H37NO6/c1-17(2)22(26)28-15-13-24-23(27)29-14-7-3-4-10-21(25)30-20-12-11-18-8-5-6-9-19(18)16-20/h18-20H,1,3-16H2,2H3,(H,24,27) |
| InChIKey | WXBFHYNCLBEBKY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|