C22H36N4O8 — CID 162024443
5-(4-acetylpiperazin-1-yl)-5-oxopentanoic acid;oxane-2,6-dione;1-piperazin-1-ylethanone (PubChem CID 162024443) has the molecular formula C22H36N4O8 and a molecular weight of 484.55 g/mol. Its IUPAC name is 5-(4-acetylpiperazin-1-yl)-5-oxopentanoic acid;oxane-2,6-dione;1-piperazin-1-ylethanone.
| Compound Name | 5-(4-acetylpiperazin-1-yl)-5-oxopentanoic acid;oxane-2,6-dione;1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 162024443 |
| Molecular Formula | C22H36N4O8 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 5-(4-acetylpiperazin-1-yl)-5-oxopentanoic acid;oxane-2,6-dione;1-piperazin-1-ylethanone |
| SMILES | CC(=O)N1CCN(C(=O)CCCC(=O)O)CC1.CC(=O)N1CCNCC1.O=C1CCCC(=O)O1 |
| InChI | InChI=1S/C11H18N2O4.C6H12N2O.C5H6O3/c1-9(14)12-5-7-13(8-6-12)10(15)3-2-4-11(16)17;1-6(9)8-4-2-7-3-5-8;6-4-2-1-3-5(7)8-4/h2-8H2,1H3,(H,16,17);7H,2-5H2,1H3;1-3H2 |
| InChIKey | YVEJEMYXWRSFGE-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 153.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|