About di(octan-2-yloxy)-oxophosphanium;molybdenum
di(octan-2-yloxy)-oxophosphanium;molybdenum (PubChem CID 162055001) has the molecular formula C16H34MoO3P+
and a molecular weight of 401.36 g/mol. Its IUPAC name is di(octan-2-yloxy)-oxophosphanium;molybdenum.
Molecular Properties
| Compound Name | di(octan-2-yloxy)-oxophosphanium;molybdenum |
| PubChem CID | 162055001 |
| Molecular Formula | C16H34MoO3P+ |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | di(octan-2-yloxy)-oxophosphanium;molybdenum |
| SMILES | CCCCCCC(C)O[P+](=O)OC(C)CCCCCC.[Mo] |
| InChI | InChI=1S/C16H34O3P.Mo/c1-5-7-9-11-13-15(3)18-20(17)19-16(4)14-12-10-8-6-2;/h15-16H,5-14H2,1-4H3;/q+1; |
| InChIKey | SQKKSWBRBVRUMX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze di(octan-2-yloxy)-oxophosphanium;molybdenum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(octan-2-yloxy)-oxophosphanium;molybdenum?
The IUPAC name of di(octan-2-yloxy)-oxophosphanium;molybdenum (CID 162055001) is di(octan-2-yloxy)-oxophosphanium;molybdenum.
What is the SMILES notation for di(octan-2-yloxy)-oxophosphanium;molybdenum?
The canonical SMILES for di(octan-2-yloxy)-oxophosphanium;molybdenum is CCCCCCC(C)O[P+](=O)OC(C)CCCCCC.[Mo].
What is the InChIKey of di(octan-2-yloxy)-oxophosphanium;molybdenum?
The InChIKey is SQKKSWBRBVRUMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O3P.Mo/c1-5-7-9-11-13-15(3)18-20(17)19-16(4)14-12-10-8-6-2;/h15-16H,5-14H2,1-4H3;/q+1;.
What are the key properties of di(octan-2-yloxy)-oxophosphanium;molybdenum?
di(octan-2-yloxy)-oxophosphanium;molybdenum has a molecular weight of 401.36 g/mol, XLogP of 6.39, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for di(octan-2-yloxy)-oxophosphanium;molybdenum is sourced from PubChem (CID 162055001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).