C28H31F2N5O3 — CID 162071110
(1R,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(2-hydroxyethoxy)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-1,6-dimethylcyclohexan-1-ol (PubChem CID 162071110) has the molecular formula C28H31F2N5O3 and a molecular weight of 523.58 g/mol. Its IUPAC name is (1R,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(2-hydroxyethoxy)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-1,6-dimethylcyclohexan-1-ol.
| Compound Name | (1R,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(2-hydroxyethoxy)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-1,6-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 162071110 |
| Molecular Formula | C28H31F2N5O3 |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | (1R,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(2-hydroxyethoxy)phenyl]imidazo[1,5-b]pyridazin-7-yl]methyl]-4-pyridinyl]-1,6-dimethylcyclohexan-1-ol |
| SMILES | C[C@H]1C[C@@H](c2ccncc2Cc2ncc3ccc(-c4c(F)cc(OCCO)cc4F)nn23)C[C@@H](N)[C@]1(C)O |
| InChI | InChI=1S/C28H31F2N5O3/c1-16-9-17(10-25(31)28(16,2)37)21-5-6-32-14-18(21)11-26-33-15-19-3-4-24(34-35(19)26)27-22(29)12-20(13-23(27)30)38-8-7-36/h3-6,12-17,25,36-37H,7-11,31H2,1-2H3/t16-,17+,25+,28+/m0/s1 |
| InChIKey | ZBCAMRXZKPZRCW-RSOOOTTCSA-N |
| XLogP | 3.62 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |