About sodium;benzene-1,2-diol;azide
sodium;benzene-1,2-diol;azide (PubChem CID 162093593) has the molecular formula C6H6N3NaO2
and a molecular weight of 175.12 g/mol. Its IUPAC name is sodium;benzene-1,2-diol;azide.
Molecular Properties
| Compound Name | sodium;benzene-1,2-diol;azide |
| PubChem CID | 162093593 |
| Molecular Formula | C6H6N3NaO2 |
| Molecular Weight | 175.12 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | sodium;benzene-1,2-diol;azide |
| SMILES | Oc1ccccc1O.[N-]=[N+]=[N-].[Na+] |
| InChI | InChI=1S/C6H6O2.N3.Na/c7-5-3-1-2-4-6(5)8;1-3-2;/h1-4,7-8H;;/q;-1;+1 |
| InChIKey | ZDYDYXYDRGKDRY-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.12 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;benzene-1,2-diol;azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzene-1,2-diol;azide?
The IUPAC name of sodium;benzene-1,2-diol;azide (CID 162093593) is sodium;benzene-1,2-diol;azide.
What is the SMILES notation for sodium;benzene-1,2-diol;azide?
The canonical SMILES for sodium;benzene-1,2-diol;azide is Oc1ccccc1O.[N-]=[N+]=[N-].[Na+].
What is the InChIKey of sodium;benzene-1,2-diol;azide?
The InChIKey is ZDYDYXYDRGKDRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.N3.Na/c7-5-3-1-2-4-6(5)8;1-3-2;/h1-4,7-8H;;/q;-1;+1.
What are the key properties of sodium;benzene-1,2-diol;azide?
sodium;benzene-1,2-diol;azide has a molecular weight of 175.12 g/mol, XLogP of -1.03, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzene-1,2-diol;azide is sourced from PubChem (CID 162093593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).