C56H77F3N4S3 — CID 162104586
4-[4,5-bis(3,5-dihexylthiophen-2-yl)-3-hexylthiophen-2-yl]-2-(5-methyl-2H-pyrrol-3-yl)-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (PubChem CID 162104586) has the molecular formula C56H77F3N4S3 and a molecular weight of 959.45 g/mol. Its IUPAC name is 4-[4,5-bis(3,5-dihexylthiophen-2-yl)-3-hexylthiophen-2-yl]-2-(5-methyl-2H-pyrrol-3-yl)-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
| Compound Name | 4-[4,5-bis(3,5-dihexylthiophen-2-yl)-3-hexylthiophen-2-yl]-2-(5-methyl-2H-pyrrol-3-yl)-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
|---|---|
| PubChem CID | 162104586 |
| Molecular Formula | C56H77F3N4S3 |
| Molecular Weight | 959.45 g/mol |
| Exact Mass | 958.53 |
| IUPAC Name | 4-[4,5-bis(3,5-dihexylthiophen-2-yl)-3-hexylthiophen-2-yl]-2-(5-methyl-2H-pyrrol-3-yl)-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| SMILES | CCCCCCc1cc(CCCCCC)c(-c2sc(-c3cc(C4=CC(C)=NC4)nc(-c4cc(C(F)(F)F)[nH]n4)c3)c(CCCCCC)c2-c2sc(CCCCCC)cc2CCCCCC)s1 |
| InChI | InChI=1S/C56H77F3N4S3/c1-7-12-17-22-27-40-33-44(29-24-19-14-9-3)64-53(40)51-46(31-26-21-16-11-5)52(66-55(51)54-41(28-23-18-13-8-2)34-45(65-54)30-25-20-15-10-4)42-35-47(43-32-39(6)60-38-43)61-48(36-42)49-37-50(63-62-49)56(57,58)59/h32-37H,7-31,38H2,1-6H3,(H,62,63) |
| InChIKey | PRLVVTLKIRCLCX-UHFFFAOYSA-N |
| XLogP | 19.15 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.45 |
| LogP ≤ 5 | 19.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|