C47H56N2O14 — CID 162105589
9H-fluoren-9-ylmethyl 4-[bis[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]piperidine-1-carboxylate;formic acid (PubChem CID 162105589) has the molecular formula C47H56N2O14 and a molecular weight of 872.97 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 4-[bis[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]piperidine-1-carboxylate;formic acid.
| Compound Name | 9H-fluoren-9-ylmethyl 4-[bis[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]piperidine-1-carboxylate;formic acid |
|---|---|
| PubChem CID | 162105589 |
| Molecular Formula | C47H56N2O14 |
| Molecular Weight | 872.97 g/mol |
| Exact Mass | 872.37 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 4-[bis[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]piperidine-1-carboxylate;formic acid |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)N1CCC(N(C[C@H](O)[C@@H](O)[C@@H]2OC(c3ccccc3)OC[C@H]2O)C[C@H](O)[C@@H](O)[C@@H]2OC(c3ccccc3)OC[C@H]2O)CC1.O=CO |
| InChI | InChI=1S/C46H54N2O12.CH2O2/c49-36(40(53)42-38(51)26-56-44(59-42)28-11-3-1-4-12-28)23-48(24-37(50)41(54)43-39(52)27-57-45(60-43)29-13-5-2-6-14-29)30-19-21-47(22-20-30)46(55)58-25-35-33-17-9-7-15-31(33)32-16-8-10-18-34(32)35;2-1-3/h1-18,30,35-45,49-54H,19-27H2;1H,(H,2,3)/t36-,37-,38+,39+,40+,41+,42+,43+,44?,45?;/m0./s1 |
| InChIKey | ZFLRHJYGIBZSCJ-IFBYUOMKSA-N |
| XLogP | 2.80 |
| TPSA | 228.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.97 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|